Gourt Home::Gourt :: Tetramethrin
| Systematic name | (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl) methyl-2,2-dimethyl-3-(2-methylprop-1-enyl) cyclopropane-1-carboxylate |
| Chemical formula | C19H25NO4 |
| Molecular mass | 331.406 g/mol |
| Density | x.xxx g/cm3 |
| Melting point | xx.x °C |
| Boiling point | xx.x °C |
| CAS number | * |
| SMILES | CC(=CC1C(C1(C)C)C(=O) OCN2C(=O)C3=C(C2=O)CCCC3)C |
| International Chemical Identifier | InChI=1/C19H25NO4/c1-11(2)9-14-15 (19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13 (12)17(20)22/h9,14-15H,5-8,10H2,1-4H3 |
| Chemical infobox | |
Tetramethrin is a potent synthetic insecticide in the pyrethroid family. It is a white crystalline solid with a melting point of 65-80 °C. The commercial product is a mixture of stereoisomers.
It is commonly used as an insecticide, and affects the insect's nervous system.
External links
Amides | Aromatic compounds | Pyrethroids | Household chemicals
"Tetramethrin"