Gourt Home::Gourt :: Ketanserin
| Ketanserin | |
|---|---|
| Chemical name | - |
| Chemical formula | C22H22FN3O3 |
| Molecular mass | 395.43 g/mol |
| CAS number | 74050-98-9 |
| SMILES | O=C(C4=CC=C(F)C=C4)C(CC3)CCN3 CCN(C2=O)C(NC1=C2C=CC=C1)=O |
Ketanserin is a serotonin receptor antagonist. It has the highest affinity for the serotonin 5-HT2A receptor, but also binds less potently to the 5-HT2C, 5-HT2B, 5-HT1D, alpha-adrenergic, and dopamine receptors. With tritium radioactively labeled ketanserin is used as a radioligand for the serotonin 5-HT2A receptor, e.g. in receptor binding assays.
External links
"Ketanserin"