Gourt Home::Gourt :: Isophthalic acid
| Isophthalic acid | |
|---|---|
| General | |
| Other names | Benzene-1,3-dicarboxylic acid meta-Phthalic acid |
| Molecular formula | C6H4(COOH)2 |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(=O)O |
| Molar mass | 166.14 g/mol |
| Appearance | White crystaline solid |
| CAS number | * |
| Properties | |
| Density and phase | 1.526 g/cm3, Solid |
| Solubility in water | Insoluble in water |
| Melting point | 345 - 348°C, sublimes |
| Boiling point | ? °C (? K) |
| Acidity (pKa) | |
| Structure | |
| Crystal structure | ? |
| Dipole moment | ? D |
| Hazards | |
| MSDS | External MSDS |
| EU classification | not listed |
| NFPA 704 | |
| Flash point | ? °C |
| Supplementary data page | |
| Structure and properties | n, εr, etc. |
| Thermodynamic data | Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| Related carboxylic acids | Phthalic acid Terephthalic acid Benzoic acid |
| Related compounds | ? |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Chemical infobox | |
Isophthalic acid, or benzene-1,3-dicarboxylic acid, is an aromatic dicarboxylic acid, with formula C6H4(COOH)2.
It is an isomer of phthalic acid and terephthalic acid.
Isophthalic acid can be obtained by oxidizing meta-xylene with chromic acid, or by fusing potassium meta-sulphobenzoate, or meta-brombenzoate with potassium formate (terephthalic acid is also formed in the last case). It melts above 300°. The barium salt (6H20) is very soluble (a distinction between phthalic and terephthalic acids). Uvitic acid, 5-methylisophthalic acid, is obtained by oxidizing mesitylene or by condensing pyroracemic acid with baryta water.
External links
"Isophthalic acid"