Gourt Home::Gourt :: Humulene
| Humulene | |
|---|---|
| Chemical name | 2,6,6,9-tetramethyl- 1,4-8-cycloundecatriene |
| Chemical formula | C15H24 |
| Molecular mass | 204.36 g/mol |
| CAS number | * |
| Density | 0.886 g/cm3 |
| Melting point | ? °C |
| Boiling point | 106-107 °C at 5 mmHg |
| SMILES | CC1(C)/C=C/C/C(C)=C/CC/C(C)=C/C1 |
| Chemical infobox | |
Humulene, or α-humulene or α-caryophyllene, is a naturally occurring monocyclic sesquiterpene. It is found in the essential oils of Humulus lupulus (hops) from which it derives its name, Lindera strychnifolia and others. It is an isomer of β-caryophyllene and the two are often found together as a mixture in nature.
It is one of the chemical compounds that contribute to the taste of the spice Vietnamese coriander.
References
- Merck Index, 12th Edition, 4789.
External links
"Humulene"