Gourt Home::Gourt :: Diatrizoic acid
| Chemical name | 3,5-diacetamido-2,4,6-triiodo-benzoic acid |
| Chemical formula | C11H9I3N2O4 |
| Molecular mass | 613.9 g/mol |
| CAS number | * |
| Density | |
| Melting point | |
| Boiling point | |
| SMILES | CC(=O)NC1=C(C(=C(C(=C1I)C(=O)O)I)NC(=O)C)I |
| Chemical infobox | |
Diatrizoic acid (or its anionic form, Diatrizoate), also known as amidotrizoic acid, or 3,5-Diacetamido-2,4,6-triiodobenzoic acid, is an iodine-containing radiocontrast agent. It is also used to kill tapeworms.
Administration
- It is given intravenously (under brand name Hypaque®, Nycomed Imaging) to enhance contrast in computed tomography, to image the kidneys and related structures, and to image blood vessels.
- It is given by orally or by enema (Gastrografin®, Gastrovist®, Gastrovision®, MD-Gastroview®) to image the gastrointestinal tract.
Contraindications
A history of sensitivity to iodine is not a contraindication to using diatrizoate, although it suggests caution in use of the agent.
"Diatrizoic acid"