Gourt Home::Gourt :: Butylated hydroxytoluene
| Butylated hydroxytoluene | |
|---|---|
| General | |
| Systematic name | 2,6-bis(1,1-dimethylethyl)-4-methylphenol |
| Other names | 2,6-di-‘’tert’’-butyl-4-methylphenol butylated hydroxytoluene BHT |
| Molecular formula | C15H24O |
| SMILES | CC(C)(C)c1c(O)c(C(C)(C)C)cc(C)c1 |
| Molar mass | 220.35 g/mol |
| Appearance | white powder |
| CAS number | * * |
| Properties | |
| Density and phase | 1.048 g/cm3, solid |
| Solubility in water | insol. |
| Melting point | 70-73 °C |
| Boiling point | 265 °C (538.15 K) |
| Acidity (pKa) | ? |
| Basicity (pKb) | ? |
| Hazards | |
| MSDS | External MSDS |
| Main hazards | ? |
| NFPA 704 | |
| Flash point | 127 °C |
| R/S statement | R: 22-36 37 38 S: 26-36 |
| RTECS number | GO7875000 |
| Related compounds | |
| Related compounds | butylated hydroxyanisole |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Chemical infobox | |
Butylated hydroxytoluene (BHT) is a fat-soluble organic compound primarily used as an antioxidant food additive (E number E321). It also used as an antioxidant in cosmetics, pharmaceutical drugs, jet fuels, rubber and petroleum products, and embalming fluid.
BHT is produced by the reaction of p-cresol with isobutylene. It was patented in 1947 and received approval of the Food and Drug Administration for use as a food additive and preservative in 1954. BHT reacts with free radicals, slowing the rate of autoxidation in food, preventing changes in the food's color, odor, and taste.
In the chemical industry it is added to tetrahydrofuran and diethyl ether in order to inhibit the formation of dangerous organic peroxides.
Controversy
Serious concerns have been raised about the use of BHT in food products. BHT is a suspected mutagen and carcinogen. There have been cases in which some individuals have had difficulty metabolizing BHT, resulting in health and behavior changes.
BHT has been banned for use in food in Japan (1958), Romania, Sweden, and Australia. The US has barred it from being used in infant foods. However some food industries have eliminated it from their products including McDonald's as of 1986.
See also
- Butylated hydroxyanisole (BHA)
External links
- Why are BHA and BHT in foods? Are they safe?
- Bioassay of BHT, includes structure
- BUTYLATED HYDROXYTOLUENE (ICSC)
- Butylated Hydroxytoluene (BHT) Antioxidant
"Butylated hydroxytoluene"